missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Triolein, 99 %, Thermo Scientific Chemicals
56.08 CHF - 1793.93 CHF
Chemische Identifikatoren
| CAS | 122-32-7 |
|---|---|
| Summenformel | C57H104O6 |
| Molekulargewicht (g/mol) | 885.45 |
| MDL-Nummer | MFCD00137563 |
| InChI-Schlüssel | PHYFQTYBJUILEZ-BSCDBXJPSA-N |
| Synonym | triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate |
| PubChem CID | 45253964 |
| IUPAC-Name | [2-[(Z)-Octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoat |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| Produktcode | Marke | Menge | Preis | Menge & Verfügbarkeit | |||||
|---|---|---|---|---|---|---|---|---|---|
| Produktcode | Marke | Menge | Preis | Menge & Verfügbarkeit | |||||
|
10541902
|
Thermo Scientific Acros
368120010 |
1 mL |
56.08 CHF
1 Milliliter |
Log in om dit product te kopen Registreer vandaag om een webaccount aan te maken | |||||
|
10190612
|
Thermo Scientific Acros
368120050 |
5 mL | N/A | N/A | N/A | ||||
|
10004983
|
Thermo Scientific Acros
368120250 |
25 mL |
501.50 CHF
25 Milliliter |
Log in om dit product te kopen Registreer vandaag om een webaccount aan te maken | |||||
|
11954961
|
Thermo Scientific Acros
368121000 |
100 mL | N/A | N/A | N/A | ||||
Beschreibung
Dieses Markenprodukt von Thermo Scientific Chemicals war ursprünglich Teil des Produktportfolios von Acros Organics. Auf einigen Dokumenten und Etiketteninformationen steht möglicherweise noch die bisherige Marke. Die ursprüngliche Produkt- oder Artikelnummer von Acros Organics oder die SKU-Referenz wurde bei Übernahme der Marke durch Thermo Scientific Chemicals nicht geändert.
Chemische Identifikatoren
| 122-32-7 | |
| 885.45 | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| 45253964 | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC |
| C57H104O6 | |
| MFCD00137563 | |
| triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate | |
| [2-[(Z)-Octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoat |
Spezifikation
| Glycerine trioleate | |
| Farblos bis hellgelb | |
| 235.0°C to 240.0°C (18.0 mmHg) | |
| 98.5% min. (GC) | |
| C57H104O6 | |
| 1.4680 to 1.4700 | |
| 02,IV,1664 | |
| 0.913 | |
| Solubility in water: insoluble in water. Other solubilities: soluble in chloroform, ether, ccl4, slightly soluble in alcohol | |
| CCCCCCCCC=CCCCCCCCC(=O)OCC(COC(=O)CCCCCCCC=CCCCCCCCC)OC(=O)CCCCCCCC=CCCCCCCCC | |
| 885.45 | |
| 885.45 | |
| Flüssigkeit |
| 122-32-7 | |
| 0.9130g/mL | |
| Echt | |
| Glasflasche | |
| (C17H33COOCH2)2CHOCOC17H33 | |
| MFCD00137563 | |
| 15,9904 | |
| triolein, glycerol trioleate, glyceryl trioleate, oleic triglyceride, trioleoylglycerol, glycerol triolein, oleic acid triglyceride, trioleoylglyceride, olein, glycerin trioleate | |
| PHYFQTYBJUILEZ-BSCDBXJPSA-N | |
| [2-[(Z)-Octadec-9-enoyl]oxy-3-[(E)-octadec-9-enoyl]oxypropyl] (E)-octadec-9-enoat | |
| 45253964 | |
| 99% |
Sicherheit und Handhabung
missing translation for 'einecsNumber' : 204-534-7
Produktidentifikator
- Glycerine trioleate
RUO – Research Use Only
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts